C18H34O3Si — CID 58557275
ethyl (2Z)-2-[(3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethylcyclopentylidene]acetate (PubChem CID 58557275) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is ethyl (2Z)-2-[(3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethylcyclopentylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethylcyclopentylidene]acetate |
|---|---|
| PubChem CID | 58557275 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | ethyl (2Z)-2-[(3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethylcyclopentylidene]acetate |
| SMILES | CCOC(=O)/C=C1/C[C@@H](CC)[C@@H](CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C18H34O3Si/c1-8-15-10-14(12-17(19)20-9-2)11-16(15)13-21-22(6,7)18(3,4)5/h12,15-16H,8-11,13H2,1-7H3/b14-12-/t15-,16-/m1/s1 |
| InChIKey | IPVBZRADUGNVLC-CZZMSJKLSA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|