C22H18BrFN6O6S — CID 58558230
N-[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]-4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide (PubChem CID 58558230) has the molecular formula C22H18BrFN6O6S and a molecular weight of 593.39 g/mol. Its IUPAC name is N-[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]-4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide.
| Compound Name | N-[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]-4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 58558230 |
| Molecular Formula | C22H18BrFN6O6S |
| Molecular Weight | 593.39 g/mol |
| Exact Mass | 592.02 |
| IUPAC Name | N-[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]-4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide |
| SMILES | O=C(Nc1nonc1-c1noc(=O)n1-c1ccc(F)c(Br)c1)c1ccc(CN2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C22H18BrFN6O6S/c23-16-11-15(5-6-17(16)24)30-20(28-35-22(30)32)18-19(27-36-26-18)25-21(31)14-3-1-13(2-4-14)12-29-7-9-37(33,34)10-8-29/h1-6,11H,7-10,12H2,(H,25,27,31) |
| InChIKey | IVLPCFGLUFDMOV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 153.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |