C41H54N2O3Si — CID 58561024
[(3S,10R,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethylbenzoate (PubChem CID 58561024) has the molecular formula C41H54N2O3Si and a molecular weight of 650.98 g/mol. Its IUPAC name is [(3S,10R,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethylbenzoate.
| Compound Name | [(3S,10R,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethylbenzoate |
|---|---|
| PubChem CID | 58561024 |
| Molecular Formula | C41H54N2O3Si |
| Molecular Weight | 650.98 g/mol |
| Exact Mass | 650.39 |
| IUPAC Name | [(3S,10R,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethylbenzoate |
| SMILES | Cc1cc(C(=O)O[C@H]2CC[C@@]3(C)C(=CCC4C3CC[C@]3(C)C(n5cnc6ccccc65)=CCC43)C2)cc(O[Si](C)(C)C(C)(C)C)c1C |
| InChI | InChI=1S/C41H54N2O3Si/c1-26-22-28(23-36(27(26)2)46-47(8,9)39(3,4)5)38(44)45-30-18-20-40(6)29(24-30)14-15-31-32-16-17-37(41(32,7)21-19-33(31)40)43-25-42-34-12-10-11-13-35(34)43/h10-14,17,22-23,25,30-33H,15-16,18-21,24H2,1-9H3/t30-,31?,32?,33?,40-,41-/m0/s1 |
| InChIKey | IKCJVOGZVDZDMH-CGQPHZLRSA-N |
| XLogP | 10.68 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.98 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|