C23H22F2N2O3S — CID 58565958
5-[(1R)-5-[(3S)-1-(3,5-difluorophenyl)piperidin-3-yl]oxy-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 58565958) has the molecular formula C23H22F2N2O3S and a molecular weight of 444.50 g/mol. Its IUPAC name is 5-[(1R)-5-[(3S)-1-(3,5-difluorophenyl)piperidin-3-yl]oxy-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(1R)-5-[(3S)-1-(3,5-difluorophenyl)piperidin-3-yl]oxy-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58565958 |
| Molecular Formula | C23H22F2N2O3S |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 5-[(1R)-5-[(3S)-1-(3,5-difluorophenyl)piperidin-3-yl]oxy-2,3-dihydro-1H-inden-1-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C([C@@H]2CCc3cc(O[C@H]4CCCN(c5cc(F)cc(F)c5)C4)ccc32)S1 |
| InChI | InChI=1S/C23H22F2N2O3S/c24-14-9-15(25)11-16(10-14)27-7-1-2-18(12-27)30-17-4-6-19-13(8-17)3-5-20(19)21-22(28)26-23(29)31-21/h4,6,8-11,18,20-21H,1-3,5,7,12H2,(H,26,28,29)/t18-,20+,21?/m0/s1 |
| InChIKey | BABTXWGXHVLZFI-PALXJHBUSA-N |
| XLogP | 4.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|