C25H27N5O6 — CID 58567077
methyl 6-[[[2-[(6-methoxycarbonyl-2-pyridinyl)methylamino]-3-(4-nitrophenyl)propyl]amino]methyl]pyridine-2-carboxylate (PubChem CID 58567077) has the molecular formula C25H27N5O6 and a molecular weight of 493.52 g/mol. Its IUPAC name is methyl 6-[[[2-[(6-methoxycarbonyl-2-pyridinyl)methylamino]-3-(4-nitrophenyl)propyl]amino]methyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[[[2-[(6-methoxycarbonyl-2-pyridinyl)methylamino]-3-(4-nitrophenyl)propyl]amino]methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 58567077 |
| Molecular Formula | C25H27N5O6 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | methyl 6-[[[2-[(6-methoxycarbonyl-2-pyridinyl)methylamino]-3-(4-nitrophenyl)propyl]amino]methyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(CNCC(Cc2ccc([N+](=O)[O-])cc2)NCc2cccc(C(=O)OC)n2)n1 |
| InChI | InChI=1S/C25H27N5O6/c1-35-24(31)22-7-3-5-18(28-22)14-26-15-20(13-17-9-11-21(12-10-17)30(33)34)27-16-19-6-4-8-23(29-19)25(32)36-2/h3-12,20,26-27H,13-16H2,1-2H3 |
| InChIKey | YDWWWVMVDZPVEI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|