C22H20Cl3N3O — CID 58571214
4-[3-[2-chloro-1-[(2,6-dichlorophenyl)methyl]-4-methylpyrrol-3-yl]-3-oxopropyl]benzenecarboximidamide (PubChem CID 58571214) has the molecular formula C22H20Cl3N3O and a molecular weight of 448.78 g/mol. Its IUPAC name is 4-[3-[2-chloro-1-[(2,6-dichlorophenyl)methyl]-4-methylpyrrol-3-yl]-3-oxopropyl]benzenecarboximidamide.
| Compound Name | 4-[3-[2-chloro-1-[(2,6-dichlorophenyl)methyl]-4-methylpyrrol-3-yl]-3-oxopropyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 58571214 |
| Molecular Formula | C22H20Cl3N3O |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 4-[3-[2-chloro-1-[(2,6-dichlorophenyl)methyl]-4-methylpyrrol-3-yl]-3-oxopropyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)c2c(C)cn(Cc3c(Cl)cccc3Cl)c2Cl)cc1 |
| InChI | InChI=1S/C22H20Cl3N3O/c1-13-11-28(12-16-17(23)3-2-4-18(16)24)21(25)20(13)19(29)10-7-14-5-8-15(9-6-14)22(26)27/h2-6,8-9,11H,7,10,12H2,1H3,(H3,26,27) |
| InChIKey | DZKCMQFJVWFYRG-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|