C19H35NO5 — CID 58572045
methyl (E,2S)-5-hydroxy-2-[(3-hydroxy-2,2-dimethylpropanoyl)amino]-5-methyldodec-3-enoate (PubChem CID 58572045) has the molecular formula C19H35NO5 and a molecular weight of 357.49 g/mol. Its IUPAC name is methyl (E,2S)-5-hydroxy-2-[(3-hydroxy-2,2-dimethylpropanoyl)amino]-5-methyldodec-3-enoate.
| Compound Name | methyl (E,2S)-5-hydroxy-2-[(3-hydroxy-2,2-dimethylpropanoyl)amino]-5-methyldodec-3-enoate |
|---|---|
| PubChem CID | 58572045 |
| Molecular Formula | C19H35NO5 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | methyl (E,2S)-5-hydroxy-2-[(3-hydroxy-2,2-dimethylpropanoyl)amino]-5-methyldodec-3-enoate |
| SMILES | CCCCCCCC(C)(O)/C=C/[C@H](NC(=O)C(C)(C)CO)C(=O)OC |
| InChI | InChI=1S/C19H35NO5/c1-6-7-8-9-10-12-19(4,24)13-11-15(16(22)25-5)20-17(23)18(2,3)14-21/h11,13,15,21,24H,6-10,12,14H2,1-5H3,(H,20,23)/b13-11+/t15-,19?/m0/s1 |
| InChIKey | AIXCNRAGZJBODF-OTMVUBOWSA-N |
| XLogP | 2.33 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|