C21H39NO5 — CID 88872316
methyl (E)-2-(butoxycarbonylamino)-5-hydroxy-5-propyldodec-3-enoate (PubChem CID 88872316) has the molecular formula C21H39NO5 and a molecular weight of 385.55 g/mol. Its IUPAC name is methyl (E)-2-(butoxycarbonylamino)-5-hydroxy-5-propyldodec-3-enoate.
| Compound Name | methyl (E)-2-(butoxycarbonylamino)-5-hydroxy-5-propyldodec-3-enoate |
|---|---|
| PubChem CID | 88872316 |
| Molecular Formula | C21H39NO5 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | methyl (E)-2-(butoxycarbonylamino)-5-hydroxy-5-propyldodec-3-enoate |
| SMILES | CCCCCCCC(O)(/C=C/C(NC(=O)OCCCC)C(=O)OC)CCC |
| InChI | InChI=1S/C21H39NO5/c1-5-8-10-11-12-15-21(25,14-7-3)16-13-18(19(23)26-4)22-20(24)27-17-9-6-2/h13,16,18,25H,5-12,14-15,17H2,1-4H3,(H,22,24)/b16-13+ |
| InChIKey | DVCUCNZRWKYUGN-DTQAZKPQSA-N |
| XLogP | 4.50 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|