C24H37NO5 — CID 75108304
methyl 5-hydroxy-2-(phenylmethoxycarbonylamino)-5-propyldodec-3-enoate (PubChem CID 75108304) has the molecular formula C24H37NO5 and a molecular weight of 419.56 g/mol. Its IUPAC name is methyl 5-hydroxy-2-(phenylmethoxycarbonylamino)-5-propyldodec-3-enoate.
| Compound Name | methyl 5-hydroxy-2-(phenylmethoxycarbonylamino)-5-propyldodec-3-enoate |
|---|---|
| PubChem CID | 75108304 |
| Molecular Formula | C24H37NO5 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | methyl 5-hydroxy-2-(phenylmethoxycarbonylamino)-5-propyldodec-3-enoate |
| SMILES | CCCCCCCC(O)(C=CC(NC(=O)OCc1ccccc1)C(=O)OC)CCC |
| InChI | InChI=1S/C24H37NO5/c1-4-6-7-8-12-17-24(28,16-5-2)18-15-21(22(26)29-3)25-23(27)30-19-20-13-10-9-11-14-20/h9-11,13-15,18,21,28H,4-8,12,16-17,19H2,1-3H3,(H,25,27) |
| InChIKey | MXSKIFGNPFXQFN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|