About (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane
(3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane (PubChem CID 58573116) has the molecular formula C9H18F2O
and a molecular weight of 180.24 g/mol. Its IUPAC name is (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane.
Molecular Properties
| Compound Name | (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane |
| PubChem CID | 58573116 |
| Molecular Formula | C9H18F2O |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane |
| SMILES | CC[C@@H](COC(F)F)C(C)(C)C |
| InChI | InChI=1S/C9H18F2O/c1-5-7(9(2,3)4)6-12-8(10)11/h7-8H,5-6H2,1-4H3/t7-/m0/s1 |
| InChIKey | ULTNUDRCYPCSRA-ZETCQYMHSA-N |
| XLogP | 3.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane?
The IUPAC name of (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane (CID 58573116) is (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane.
What is the SMILES notation for (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane?
The canonical SMILES for (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane is CC[C@@H](COC(F)F)C(C)(C)C.
What is the InChIKey of (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane?
The InChIKey is ULTNUDRCYPCSRA-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H18F2O/c1-5-7(9(2,3)4)6-12-8(10)11/h7-8H,5-6H2,1-4H3/t7-/m0/s1.
What are the key properties of (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane?
(3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane has a molecular weight of 180.24 g/mol, XLogP of 3.30, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane is sourced from PubChem (CID 58573116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).