C9H18F2O — CID 58573116
(3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane (PubChem CID 58573116) has the molecular formula C9H18F2O and a molecular weight of 180.24 g/mol. Its IUPAC name is (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane.
| Compound Name | (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane |
|---|---|
| PubChem CID | 58573116 |
| Molecular Formula | C9H18F2O |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (3R)-3-(difluoromethoxymethyl)-2,2-dimethylpentane |
| SMILES | CC[C@@H](COC(F)F)C(C)(C)C |
| InChI | InChI=1S/C9H18F2O/c1-5-7(9(2,3)4)6-12-8(10)11/h7-8H,5-6H2,1-4H3/t7-/m0/s1 |
| InChIKey | ULTNUDRCYPCSRA-ZETCQYMHSA-N |
| XLogP | 3.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |