C6H12B2N2O3 — CID 58583120
CID 58583120 (PubChem CID 58583120) has the molecular formula C6H12B2N2O3 and a molecular weight of 181.80 g/mol.
| Compound Name | CID 58583120 |
|---|---|
| PubChem CID | 58583120 |
| Molecular Formula | C6H12B2N2O3 |
| Molecular Weight | 181.80 g/mol |
| Exact Mass | 182.10 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@H](CNB(C)O)C(C)=O |
| InChI | InChI=1S/C6H12B2N2O3/c1-4(11)5(10-6(7)12)3-9-8(2)13/h5,9,13H,3H2,1-2H3,(H,10,12)/t5-/m1/s1 |
| InChIKey | ATKGWPGHKVPAGW-RXMQYKEDSA-N |
| XLogP | -1.48 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.80 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|