C12H25BN4O4S — CID 22089253
N-[3-[[1-(ethylamino)-1-oxobutan-2-yl]amino]-3-oxo-2-[(2-sulfanylacetyl)amino]propyl]-methylboronamidic acid (PubChem CID 22089253) has the molecular formula C12H25BN4O4S and a molecular weight of 332.24 g/mol. Its IUPAC name is N-[3-[[1-(ethylamino)-1-oxobutan-2-yl]amino]-3-oxo-2-[(2-sulfanylacetyl)amino]propyl]-methylboronamidic acid.
| Compound Name | N-[3-[[1-(ethylamino)-1-oxobutan-2-yl]amino]-3-oxo-2-[(2-sulfanylacetyl)amino]propyl]-methylboronamidic acid |
|---|---|
| PubChem CID | 22089253 |
| Molecular Formula | C12H25BN4O4S |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-[3-[[1-(ethylamino)-1-oxobutan-2-yl]amino]-3-oxo-2-[(2-sulfanylacetyl)amino]propyl]-methylboronamidic acid |
| SMILES | CCNC(=O)C(CC)NC(=O)C(CNB(C)O)NC(=O)CS |
| InChI | InChI=1S/C12H25BN4O4S/c1-4-8(11(19)14-5-2)17-12(20)9(6-15-13(3)21)16-10(18)7-22/h8-9,15,21-22H,4-7H2,1-3H3,(H,14,19)(H,16,18)(H,17,20) |
| InChIKey | UYZVLOMXIVODFW-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|