C11H21N3O3S2 — CID 134204313
N-ethyl-4,5-bis[(2-sulfanylacetyl)amino]pentanamide (PubChem CID 134204313) has the molecular formula C11H21N3O3S2 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-ethyl-4,5-bis[(2-sulfanylacetyl)amino]pentanamide.
| Compound Name | N-ethyl-4,5-bis[(2-sulfanylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 134204313 |
| Molecular Formula | C11H21N3O3S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-ethyl-4,5-bis[(2-sulfanylacetyl)amino]pentanamide |
| SMILES | CCNC(=O)CCC(CNC(=O)CS)NC(=O)CS |
| InChI | InChI=1S/C11H21N3O3S2/c1-2-12-9(15)4-3-8(14-11(17)7-19)5-13-10(16)6-18/h8,18-19H,2-7H2,1H3,(H,12,15)(H,13,16)(H,14,17) |
| InChIKey | LWDPBWJKHRRWQC-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|