C20H33N7O6S2 — CID 54464504
N-ethyl-2-[[3-[[2-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]acetyl]amino]-2-[(2-sulfanylacetyl)amino]propanoyl]amino]butanamide (PubChem CID 54464504) has the molecular formula C20H33N7O6S2 and a molecular weight of 531.66 g/mol. Its IUPAC name is N-ethyl-2-[[3-[[2-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]acetyl]amino]-2-[(2-sulfanylacetyl)amino]propanoyl]amino]butanamide.
| Compound Name | N-ethyl-2-[[3-[[2-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]acetyl]amino]-2-[(2-sulfanylacetyl)amino]propanoyl]amino]butanamide |
|---|---|
| PubChem CID | 54464504 |
| Molecular Formula | C20H33N7O6S2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | N-ethyl-2-[[3-[[2-[[2-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)acetyl]amino]acetyl]amino]-2-[(2-sulfanylacetyl)amino]propanoyl]amino]butanamide |
| SMILES | CCNC(=O)C(CC)NC(=O)C(CNC(=O)CNC(=O)CC1SCC2NC(=O)NC21)NC(=O)CS |
| InChI | InChI=1S/C20H33N7O6S2/c1-3-10(18(31)21-4-2)25-19(32)11(24-16(30)8-34)6-22-15(29)7-23-14(28)5-13-17-12(9-35-13)26-20(33)27-17/h10-13,17,34H,3-9H2,1-2H3,(H,21,31)(H,22,29)(H,23,28)(H,24,30)(H,25,32)(H2,26,27,33) |
| InChIKey | AODCHSZIFLCCNQ-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 186.63 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|