C19H15NO4 — CID 58586242
(1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid (PubChem CID 58586242) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid.
| Compound Name | (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 58586242 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid |
| SMILES | CC1(C)O/C(=C2/C(=O)Nc3ccccc32)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C19H15NO4/c1-19(2)13-9-10(18(22)23)7-8-11(13)16(24-19)15-12-5-3-4-6-14(12)20-17(15)21/h3-9H,1-2H3,(H,20,21)(H,22,23)/b16-15+ |
| InChIKey | XUZRGARUYWPGNN-FOCLMDBBSA-N |
| XLogP | 3.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|