About (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid
(1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid (PubChem CID 58586242) has the molecular formula C19H15NO4
and a molecular weight of 321.33 g/mol. Its IUPAC name is (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid.
Molecular Properties
| Compound Name | (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid |
| PubChem CID | 58586242 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid |
| SMILES | CC1(C)O/C(=C2/C(=O)Nc3ccccc32)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C19H15NO4/c1-19(2)13-9-10(18(22)23)7-8-11(13)16(24-19)15-12-5-3-4-6-14(12)20-17(15)21/h3-9H,1-2H3,(H,20,21)(H,22,23)/b16-15+ |
| InChIKey | XUZRGARUYWPGNN-FOCLMDBBSA-N |
| XLogP | 3.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid?
The IUPAC name of (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid (CID 58586242) is (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid.
What is the SMILES notation for (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid?
The canonical SMILES for (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid is CC1(C)O/C(=C2/C(=O)Nc3ccccc32)c2ccc(C(=O)O)cc21.
What is the InChIKey of (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid?
The InChIKey is XUZRGARUYWPGNN-FOCLMDBBSA-N. The full InChI is InChI=1S/C19H15NO4/c1-19(2)13-9-10(18(22)23)7-8-11(13)16(24-19)15-12-5-3-4-6-14(12)20-17(15)21/h3-9H,1-2H3,(H,20,21)(H,22,23)/b16-15+.
What are the key properties of (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid?
(1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid has a molecular weight of 321.33 g/mol, XLogP of 3.47, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-3,3-dimethyl-1-(2-oxo-1H-indol-3-ylidene)-2-benzofuran-5-carboxylic acid is sourced from PubChem (CID 58586242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).