C15H20Cl2O2 — CID 58587155
4a,5-bis(chloromethyl)-2-hydroxy-3-prop-1-en-2-yl-2,3,4,5,6,8a-hexahydronaphthalen-1-one (PubChem CID 58587155) has the molecular formula C15H20Cl2O2 and a molecular weight of 303.23 g/mol. Its IUPAC name is 4a,5-bis(chloromethyl)-2-hydroxy-3-prop-1-en-2-yl-2,3,4,5,6,8a-hexahydronaphthalen-1-one.
| Compound Name | 4a,5-bis(chloromethyl)-2-hydroxy-3-prop-1-en-2-yl-2,3,4,5,6,8a-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 58587155 |
| Molecular Formula | C15H20Cl2O2 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 4a,5-bis(chloromethyl)-2-hydroxy-3-prop-1-en-2-yl-2,3,4,5,6,8a-hexahydronaphthalen-1-one |
| SMILES | C=C(C)C1CC2(CCl)C(CCl)CC=CC2C(=O)C1O |
| InChI | InChI=1S/C15H20Cl2O2/c1-9(2)11-6-15(8-17)10(7-16)4-3-5-12(15)14(19)13(11)18/h3,5,10-13,18H,1,4,6-8H2,2H3 |
| InChIKey | ZDQHRKDKYSSZSF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|