C22H25ClN5O3 — CID 58589377
CID 58589377 (PubChem CID 58589377) has the molecular formula C22H25ClN5O3 and a molecular weight of 442.93 g/mol.
| Compound Name | CID 58589377 |
|---|---|
| PubChem CID | 58589377 |
| Molecular Formula | C22H25ClN5O3 |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C1[CH]N(CCCn2nc3ccccn3c2=O)CCN1c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H25ClN5O3/c1-2-31-21(29)19-16-25(13-14-26(19)18-8-5-7-17(23)15-18)10-6-12-28-22(30)27-11-4-3-9-20(27)24-28/h3-5,7-9,11,15-16,19H,2,6,10,12-14H2,1H3 |
| InChIKey | MSFBOJFNSPZZNE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |