C26H35F2IN2O — CID 58591522
(2R,3S)-3-amino-1-[[1-(3-tert-butyl-5-iodophenyl)cyclohexyl]amino]-4-(3,5-difluorophenyl)butan-2-ol (PubChem CID 58591522) has the molecular formula C26H35F2IN2O and a molecular weight of 556.48 g/mol. Its IUPAC name is (2R,3S)-3-amino-1-[[1-(3-tert-butyl-5-iodophenyl)cyclohexyl]amino]-4-(3,5-difluorophenyl)butan-2-ol.
| Compound Name | (2R,3S)-3-amino-1-[[1-(3-tert-butyl-5-iodophenyl)cyclohexyl]amino]-4-(3,5-difluorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 58591522 |
| Molecular Formula | C26H35F2IN2O |
| Molecular Weight | 556.48 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | (2R,3S)-3-amino-1-[[1-(3-tert-butyl-5-iodophenyl)cyclohexyl]amino]-4-(3,5-difluorophenyl)butan-2-ol |
| SMILES | CC(C)(C)c1cc(I)cc(C2(NC[C@@H](O)[C@@H](N)Cc3cc(F)cc(F)c3)CCCCC2)c1 |
| InChI | InChI=1S/C26H35F2IN2O/c1-25(2,3)18-12-19(14-22(29)13-18)26(7-5-4-6-8-26)31-16-24(32)23(30)11-17-9-20(27)15-21(28)10-17/h9-10,12-15,23-24,31-32H,4-8,11,16,30H2,1-3H3/t23-,24+/m0/s1 |
| InChIKey | TUATVZAIXXNLSI-BJKOFHAPSA-N |
| XLogP | 5.55 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.48 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|