C13H26N4O6 — CID 58593439
4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide (PubChem CID 58593439) has the molecular formula C13H26N4O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide.
| Compound Name | 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide |
|---|---|
| PubChem CID | 58593439 |
| Molecular Formula | C13H26N4O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide |
| SMILES | NC(CCC(=O)NCO)(CCC(=O)NCO)CCC(=O)NCO |
| InChI | InChI=1S/C13H26N4O6/c14-13(4-1-10(21)15-7-18,5-2-11(22)16-8-19)6-3-12(23)17-9-20/h18-20H,1-9,14H2,(H,15,21)(H,16,22)(H,17,23) |
| InChIKey | BFMVAEAGFIBNAH-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 174.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|