About 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide
4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide (PubChem CID 58593439) has the molecular formula C13H26N4O6
and a molecular weight of 334.37 g/mol. Its IUPAC name is 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide.
Molecular Properties
| Compound Name | 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide |
| PubChem CID | 58593439 |
| Molecular Formula | C13H26N4O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide |
| SMILES | NC(CCC(=O)NCO)(CCC(=O)NCO)CCC(=O)NCO |
| InChI | InChI=1S/C13H26N4O6/c14-13(4-1-10(21)15-7-18,5-2-11(22)16-8-19)6-3-12(23)17-9-20/h18-20H,1-9,14H2,(H,15,21)(H,16,22)(H,17,23) |
| InChIKey | BFMVAEAGFIBNAH-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 174.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide?
The IUPAC name of 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide (CID 58593439) is 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide.
What is the SMILES notation for 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide?
The canonical SMILES for 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide is NC(CCC(=O)NCO)(CCC(=O)NCO)CCC(=O)NCO.
What is the InChIKey of 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide?
The InChIKey is BFMVAEAGFIBNAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N4O6/c14-13(4-1-10(21)15-7-18,5-2-11(22)16-8-19)6-3-12(23)17-9-20/h18-20H,1-9,14H2,(H,15,21)(H,16,22)(H,17,23).
What are the key properties of 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide?
4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide has a molecular weight of 334.37 g/mol, XLogP of -2.78, 12 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N,N'-bis(hydroxymethyl)-4-[3-(hydroxymethylamino)-3-oxopropyl]heptanediamide is sourced from PubChem (CID 58593439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).