C20H43N3O3 — CID 144742337
4-amino-N-ethyl-N'-methyl-4-(3-oxobutyl)heptanediamide;propane (PubChem CID 144742337) has the molecular formula C20H43N3O3 and a molecular weight of 373.58 g/mol. Its IUPAC name is 4-amino-N-ethyl-N'-methyl-4-(3-oxobutyl)heptanediamide;propane.
| Compound Name | 4-amino-N-ethyl-N'-methyl-4-(3-oxobutyl)heptanediamide;propane |
|---|---|
| PubChem CID | 144742337 |
| Molecular Formula | C20H43N3O3 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | 4-amino-N-ethyl-N'-methyl-4-(3-oxobutyl)heptanediamide;propane |
| SMILES | CCC.CCC.CCNC(=O)CCC(N)(CCC(C)=O)CCC(=O)NC |
| InChI | InChI=1S/C14H27N3O3.2C3H8/c1-4-17-13(20)7-10-14(15,8-5-11(2)18)9-6-12(19)16-3;2*1-3-2/h4-10,15H2,1-3H3,(H,16,19)(H,17,20);2*3H2,1-2H3 |
| InChIKey | FQAPBDDLBWBWNH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |