C17H25N3O3S — CID 58600323
1-[[3-[2-(dimethylamino)ethyl]-1H-indol-6-yl]methylsulfonyl]pyrrolidin-2-ol (PubChem CID 58600323) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 1-[[3-[2-(dimethylamino)ethyl]-1H-indol-6-yl]methylsulfonyl]pyrrolidin-2-ol.
| Compound Name | 1-[[3-[2-(dimethylamino)ethyl]-1H-indol-6-yl]methylsulfonyl]pyrrolidin-2-ol |
|---|---|
| PubChem CID | 58600323 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-[[3-[2-(dimethylamino)ethyl]-1H-indol-6-yl]methylsulfonyl]pyrrolidin-2-ol |
| SMILES | CN(C)CCc1c[nH]c2cc(CS(=O)(=O)N3CCCC3O)ccc12 |
| InChI | InChI=1S/C17H25N3O3S/c1-19(2)9-7-14-11-18-16-10-13(5-6-15(14)16)12-24(22,23)20-8-3-4-17(20)21/h5-6,10-11,17-18,21H,3-4,7-9,12H2,1-2H3 |
| InChIKey | PSYHQZNIKYMMKU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |