C27H45N3O8 — CID 58605805
3-[[(5S)-6-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-2,2-dimethyl-3,4,4a,5,7,7a-hexahydropyrano[2,3-c]pyrrole-5-carbonyl]amino]-2-oxohexanoic acid (PubChem CID 58605805) has the molecular formula C27H45N3O8 and a molecular weight of 539.67 g/mol. Its IUPAC name is 3-[[(5S)-6-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-2,2-dimethyl-3,4,4a,5,7,7a-hexahydropyrano[2,3-c]pyrrole-5-carbonyl]amino]-2-oxohexanoic acid.
| Compound Name | 3-[[(5S)-6-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-2,2-dimethyl-3,4,4a,5,7,7a-hexahydropyrano[2,3-c]pyrrole-5-carbonyl]amino]-2-oxohexanoic acid |
|---|---|
| PubChem CID | 58605805 |
| Molecular Formula | C27H45N3O8 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | 3-[[(5S)-6-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-2,2-dimethyl-3,4,4a,5,7,7a-hexahydropyrano[2,3-c]pyrrole-5-carbonyl]amino]-2-oxohexanoic acid |
| SMILES | CCCC(NC(=O)[C@@H]1C2CCC(C)(C)OC2CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)C(=O)O |
| InChI | InChI=1S/C27H45N3O8/c1-10-11-16(19(31)23(34)35)28-21(32)18-15-12-13-27(8,9)37-17(15)14-30(18)22(33)20(25(2,3)4)29-24(36)38-26(5,6)7/h15-18,20H,10-14H2,1-9H3,(H,28,32)(H,29,36)(H,34,35)/t15?,16?,17?,18-,20+/m0/s1 |
| InChIKey | YADZEFGVJSSUDR-VZIDXPSOSA-N |
| XLogP | 2.65 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|