About 2-(methanidyldisulfanyl)ethyl propanoate;yttrium;hydrate
2-(methanidyldisulfanyl)ethyl propanoate;yttrium;hydrate (PubChem CID 58607982) has the molecular formula C6H13O3S2Y-
and a molecular weight of 286.21 g/mol. Its IUPAC name is 2-(methanidyldisulfanyl)ethyl propanoate;yttrium;hydrate.
Molecular Properties
| Compound Name | 2-(methanidyldisulfanyl)ethyl propanoate;yttrium;hydrate |
| PubChem CID | 58607982 |
| Molecular Formula | C6H13O3S2Y- |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.94 |
| IUPAC Name | 2-(methanidyldisulfanyl)ethyl propanoate;yttrium;hydrate |
| SMILES | O.[CH2-]SSCCOC(=O)CC.[Y] |
| InChI | InChI=1S/C6H11O2S2.H2O.Y/c1-3-6(7)8-4-5-10-9-2;;/h2-5H2,1H3;1H2;/q-1;; |
| InChIKey | VFMKNYXSYJIHPN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 57.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-(methanidyldisulfanyl)ethyl propanoate;yttrium;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methanidyldisulfanyl)ethyl propanoate;yttrium;hydrate?
The IUPAC name of 2-(methanidyldisulfanyl)ethyl propanoate;yttrium;hydrate (CID 58607982) is 2-(methanidyldisulfanyl)ethyl propanoate;yttrium;hydrate.
What is the SMILES notation for 2-(methanidyldisulfanyl)ethyl propanoate;yttrium;hydrate?
The canonical SMILES for 2-(methanidyldisulfanyl)ethyl propanoate;yttrium;hydrate is O.[CH2-]SSCCOC(=O)CC.[Y].
What is the InChIKey of 2-(methanidyldisulfanyl)ethyl propanoate;yttrium;hydrate?
The InChIKey is VFMKNYXSYJIHPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11O2S2.H2O.Y/c1-3-6(7)8-4-5-10-9-2;;/h2-5H2,1H3;1H2;/q-1;;.
What are the key properties of 2-(methanidyldisulfanyl)ethyl propanoate;yttrium;hydrate?
2-(methanidyldisulfanyl)ethyl propanoate;yttrium;hydrate has a molecular weight of 286.21 g/mol, XLogP of 1.29, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methanidyldisulfanyl)ethyl propanoate;yttrium;hydrate is sourced from PubChem (CID 58607982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).