C19H18F3NSi — CID 58611146
(E)-2,2,2-trifluoro-1-phenanthren-9-yl-N-trimethylsilylethanimine (PubChem CID 58611146) has the molecular formula C19H18F3NSi and a molecular weight of 345.44 g/mol. Its IUPAC name is (E)-2,2,2-trifluoro-1-phenanthren-9-yl-N-trimethylsilylethanimine.
| Compound Name | (E)-2,2,2-trifluoro-1-phenanthren-9-yl-N-trimethylsilylethanimine |
|---|---|
| PubChem CID | 58611146 |
| Molecular Formula | C19H18F3NSi |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (E)-2,2,2-trifluoro-1-phenanthren-9-yl-N-trimethylsilylethanimine |
| SMILES | C[Si](C)(C)/N=C(\c1cc2ccccc2c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C19H18F3NSi/c1-24(2,3)23-18(19(20,21)22)17-12-13-8-4-5-9-14(13)15-10-6-7-11-16(15)17/h4-12H,1-3H3/b23-18+ |
| InChIKey | GWZGVJRIHKUMTP-PTGBLXJZSA-N |
| XLogP | 6.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|