C22H12F2N3OPt- — CID 58612687
(2,4-difluorobenzene-6-id-1-yl)-[6-(6-pyridin-2-yl-2-pyridinyl)-2-pyridinyl]methanone;platinum (PubChem CID 58612687) has the molecular formula C22H12F2N3OPt- and a molecular weight of 567.43 g/mol. Its IUPAC name is (2,4-difluorobenzene-6-id-1-yl)-[6-(6-pyridin-2-yl-2-pyridinyl)-2-pyridinyl]methanone;platinum.
| Compound Name | (2,4-difluorobenzene-6-id-1-yl)-[6-(6-pyridin-2-yl-2-pyridinyl)-2-pyridinyl]methanone;platinum |
|---|---|
| PubChem CID | 58612687 |
| Molecular Formula | C22H12F2N3OPt- |
| Molecular Weight | 567.43 g/mol |
| Exact Mass | 567.06 |
| IUPAC Name | (2,4-difluorobenzene-6-id-1-yl)-[6-(6-pyridin-2-yl-2-pyridinyl)-2-pyridinyl]methanone;platinum |
| SMILES | O=C(c1cccc(-c2cccc(-c3ccccn3)n2)n1)c1[c-]cc(F)cc1F.[Pt] |
| InChI | InChI=1S/C22H12F2N3O.Pt/c23-14-10-11-15(16(24)13-14)22(28)21-9-4-8-20(27-21)19-7-3-6-18(26-19)17-5-1-2-12-25-17;/h1-10,12-13H;/q-1; |
| InChIKey | ZBTHGUCBWWNJBW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|