C27H21N5O12S3 — CID 58612874
8-[2-[2-[(4-azidobenzoyl)amino]ethylamino]-2-oxoethoxy]-3,6-bis(trioxidanylsulfanyl)pyrene-1-sulfonic acid (PubChem CID 58612874) has the molecular formula C27H21N5O12S3 and a molecular weight of 703.69 g/mol. Its IUPAC name is 8-[2-[2-[(4-azidobenzoyl)amino]ethylamino]-2-oxoethoxy]-3,6-bis(trioxidanylsulfanyl)pyrene-1-sulfonic acid.
| Compound Name | 8-[2-[2-[(4-azidobenzoyl)amino]ethylamino]-2-oxoethoxy]-3,6-bis(trioxidanylsulfanyl)pyrene-1-sulfonic acid |
|---|---|
| PubChem CID | 58612874 |
| Molecular Formula | C27H21N5O12S3 |
| Molecular Weight | 703.69 g/mol |
| Exact Mass | 703.03 |
| IUPAC Name | 8-[2-[2-[(4-azidobenzoyl)amino]ethylamino]-2-oxoethoxy]-3,6-bis(trioxidanylsulfanyl)pyrene-1-sulfonic acid |
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)NCCNC(=O)COc2cc(SOOO)c3ccc4c(SOOO)cc(S(=O)(=O)O)c5ccc2c3c45)cc1 |
| InChI | InChI=1S/C27H21N5O12S3/c28-32-31-15-3-1-14(2-4-15)27(34)30-10-9-29-24(33)13-40-20-11-21(45-43-41-35)17-6-7-18-22(46-44-42-36)12-23(47(37,38)39)19-8-5-16(20)25(17)26(18)19/h1-8,11-12,35-36H,9-10,13H2,(H,29,33)(H,30,34)(H,37,38,39) |
| InChIKey | KIDKKWZJZOZUEW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 247.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.69 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|