C20H24N2O9S2 — CID 59121518
5-[4-[2-(ethylamino)-2-oxoethoxy]-3-(trioxidanylsulfanyl)phenyl]-2-(2-iminobutoxy)benzenesulfonic acid (PubChem CID 59121518) has the molecular formula C20H24N2O9S2 and a molecular weight of 500.55 g/mol. Its IUPAC name is 5-[4-[2-(ethylamino)-2-oxoethoxy]-3-(trioxidanylsulfanyl)phenyl]-2-(2-iminobutoxy)benzenesulfonic acid.
| Compound Name | 5-[4-[2-(ethylamino)-2-oxoethoxy]-3-(trioxidanylsulfanyl)phenyl]-2-(2-iminobutoxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 59121518 |
| Molecular Formula | C20H24N2O9S2 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | 5-[4-[2-(ethylamino)-2-oxoethoxy]-3-(trioxidanylsulfanyl)phenyl]-2-(2-iminobutoxy)benzenesulfonic acid |
| SMILES | [H]/N=C(\CC)COc1ccc(-c2ccc(OCC(=O)NCC)c(SOOO)c2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C20H24N2O9S2/c1-3-15(21)11-28-17-8-6-14(10-19(17)33(25,26)27)13-5-7-16(18(9-13)32-31-30-24)29-12-20(23)22-4-2/h5-10,21,24H,3-4,11-12H2,1-2H3,(H,22,23)(H,25,26,27)/b21-15+ |
| InChIKey | XFLCZFBALFWNNM-RCCKNPSSSA-N |
| XLogP | 3.35 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|