C20H22N2Na2O9S2 — CID 23514905
disodium;5-[4-[1-(ethylamino)ethenoxy]-3-oxidoperoxysulfanylphenyl]-2-[2-(ethylamino)-2-oxoethoxy]benzenesulfonate (PubChem CID 23514905) has the molecular formula C20H22N2Na2O9S2 and a molecular weight of 544.52 g/mol. Its IUPAC name is disodium;5-[4-[1-(ethylamino)ethenoxy]-3-oxidoperoxysulfanylphenyl]-2-[2-(ethylamino)-2-oxoethoxy]benzenesulfonate.
| Compound Name | disodium;5-[4-[1-(ethylamino)ethenoxy]-3-oxidoperoxysulfanylphenyl]-2-[2-(ethylamino)-2-oxoethoxy]benzenesulfonate |
|---|---|
| PubChem CID | 23514905 |
| Molecular Formula | C20H22N2Na2O9S2 |
| Molecular Weight | 544.52 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | disodium;5-[4-[1-(ethylamino)ethenoxy]-3-oxidoperoxysulfanylphenyl]-2-[2-(ethylamino)-2-oxoethoxy]benzenesulfonate |
| SMILES | C=C(NCC)Oc1ccc(-c2ccc(OCC(=O)NCC)c(S(=O)(=O)[O-])c2)cc1SOO[O-].[Na+].[Na+] |
| InChI | InChI=1S/C20H24N2O9S2.2Na/c1-4-21-13(3)29-16-8-6-14(10-18(16)32-31-30-24)15-7-9-17(19(11-15)33(25,26)27)28-12-20(23)22-5-2;;/h6-11,21,24H,3-5,12H2,1-2H3,(H,22,23)(H,25,26,27);;/q;2*+1/p-2 |
| InChIKey | FAJOJVGIIBODKT-UHFFFAOYSA-L |
| XLogP | -4.53 |
| TPSA | 158.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.52 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|