C23H30N2O3 — CID 58615151
N-[(4R,4aS,7S,12bR)-3-(cyclopropylmethyl)-9-hydroxy-7-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]acetamide (PubChem CID 58615151) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is N-[(4R,4aS,7S,12bR)-3-(cyclopropylmethyl)-9-hydroxy-7-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]acetamide.
| Compound Name | N-[(4R,4aS,7S,12bR)-3-(cyclopropylmethyl)-9-hydroxy-7-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]acetamide |
|---|---|
| PubChem CID | 58615151 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | N-[(4R,4aS,7S,12bR)-3-(cyclopropylmethyl)-9-hydroxy-7-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]acetamide |
| SMILES | CC(=O)N[C@@]12CC[C@H](C)C3Oc4c(O)ccc5c4[C@@]31CCN(CC1CC1)[C@@H]2C5 |
| InChI | InChI=1S/C23H30N2O3/c1-13-7-8-23(24-14(2)26)18-11-16-5-6-17(27)20-19(16)22(23,21(13)28-20)9-10-25(18)12-15-3-4-15/h5-6,13,15,18,21,27H,3-4,7-12H2,1-2H3,(H,24,26)/t13-,18+,21?,22-,23+/m0/s1 |
| InChIKey | CWHFRYJWEWTDBI-VRWWZBMUSA-N |
| XLogP | 2.74 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |