C28H39N3O5 — CID 58615233
tert-butyl 2-[[(4R,4aS,7R,12bR)-4a-acetamido-3-(cyclopropylmethyl)-9-hydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]acetate (PubChem CID 58615233) has the molecular formula C28H39N3O5 and a molecular weight of 497.64 g/mol. Its IUPAC name is tert-butyl 2-[[(4R,4aS,7R,12bR)-4a-acetamido-3-(cyclopropylmethyl)-9-hydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]acetate.
| Compound Name | tert-butyl 2-[[(4R,4aS,7R,12bR)-4a-acetamido-3-(cyclopropylmethyl)-9-hydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]acetate |
|---|---|
| PubChem CID | 58615233 |
| Molecular Formula | C28H39N3O5 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | tert-butyl 2-[[(4R,4aS,7R,12bR)-4a-acetamido-3-(cyclopropylmethyl)-9-hydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]acetate |
| SMILES | CC(=O)N[C@@]12CC[C@@H](NCC(=O)OC(C)(C)C)C3Oc4c(O)ccc5c4[C@@]31CCN(CC1CC1)[C@@H]2C5 |
| InChI | InChI=1S/C28H39N3O5/c1-16(32)30-28-10-9-19(29-14-22(34)36-26(2,3)4)25-27(28)11-12-31(15-17-5-6-17)21(28)13-18-7-8-20(33)24(35-25)23(18)27/h7-8,17,19,21,25,29,33H,5-6,9-15H2,1-4H3,(H,30,32)/t19-,21-,25?,27+,28-/m1/s1 |
| InChIKey | LWGSEYVMOJWZIC-SSRDEXNLSA-N |
| XLogP | 2.40 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |