C27H30N2O2S — CID 58615642
N-[[3-(1H-indol-3-ylmethyl)phenyl]methyl]-4-pentylbenzenesulfonamide (PubChem CID 58615642) has the molecular formula C27H30N2O2S and a molecular weight of 446.62 g/mol. Its IUPAC name is N-[[3-(1H-indol-3-ylmethyl)phenyl]methyl]-4-pentylbenzenesulfonamide.
| Compound Name | N-[[3-(1H-indol-3-ylmethyl)phenyl]methyl]-4-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 58615642 |
| Molecular Formula | C27H30N2O2S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[[3-(1H-indol-3-ylmethyl)phenyl]methyl]-4-pentylbenzenesulfonamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)NCc2cccc(Cc3c[nH]c4ccccc34)c2)cc1 |
| InChI | InChI=1S/C27H30N2O2S/c1-2-3-4-8-21-13-15-25(16-14-21)32(30,31)29-19-23-10-7-9-22(17-23)18-24-20-28-27-12-6-5-11-26(24)27/h5-7,9-17,20,28-29H,2-4,8,18-19H2,1H3 |
| InChIKey | OGCVSGJPFGHWJJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|