C35H39N3O8S2 — CID 58626452
2-[5-[ethyl(3-phenylpropyl)sulfamoyl]-2,3,4-trihydroxybenzoyl]-N-(2-phenylethyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide (PubChem CID 58626452) has the molecular formula C35H39N3O8S2 and a molecular weight of 693.84 g/mol. Its IUPAC name is 2-[5-[ethyl(3-phenylpropyl)sulfamoyl]-2,3,4-trihydroxybenzoyl]-N-(2-phenylethyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide.
| Compound Name | 2-[5-[ethyl(3-phenylpropyl)sulfamoyl]-2,3,4-trihydroxybenzoyl]-N-(2-phenylethyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 58626452 |
| Molecular Formula | C35H39N3O8S2 |
| Molecular Weight | 693.84 g/mol |
| Exact Mass | 693.22 |
| IUPAC Name | 2-[5-[ethyl(3-phenylpropyl)sulfamoyl]-2,3,4-trihydroxybenzoyl]-N-(2-phenylethyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
| SMILES | CCN(CCCc1ccccc1)S(=O)(=O)c1cc(C(=O)N2CCc3ccc(S(=O)(=O)NCCc4ccccc4)cc3C2)c(O)c(O)c1O |
| InChI | InChI=1S/C35H39N3O8S2/c1-2-38(20-9-14-25-10-5-3-6-11-25)48(45,46)31-23-30(32(39)34(41)33(31)40)35(42)37-21-18-27-15-16-29(22-28(27)24-37)47(43,44)36-19-17-26-12-7-4-8-13-26/h3-8,10-13,15-16,22-23,36,39-41H,2,9,14,17-21,24H2,1H3 |
| InChIKey | HUQSRNGQUKCBGT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 164.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|