C16H16ClFN2O2 — CID 58631163
2-chloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide (PubChem CID 58631163) has the molecular formula C16H16ClFN2O2 and a molecular weight of 322.77 g/mol. Its IUPAC name is 2-chloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide.
| Compound Name | 2-chloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 58631163 |
| Molecular Formula | C16H16ClFN2O2 |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-chloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide |
| SMILES | O=C(CCl)N[C@H](CF)[C@H](O)c1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C16H16ClFN2O2/c17-8-15(21)20-14(9-18)16(22)12-5-3-11(4-6-12)13-2-1-7-19-10-13/h1-7,10,14,16,22H,8-9H2,(H,20,21)/t14-,16-/m1/s1 |
| InChIKey | DQTFWNQAALYGRR-GDBMZVCRSA-N |
| XLogP | 2.48 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|