C31H31F2NO7 — CID 58632746
(2S,3S,4R,5R,6S)-6-[[4-[(2S,3R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)propyl]-4-oxoazetidin-2-yl]phenyl]methyl]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 58632746) has the molecular formula C31H31F2NO7 and a molecular weight of 567.59 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-6-[[4-[(2S,3R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)propyl]-4-oxoazetidin-2-yl]phenyl]methyl]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5R,6S)-6-[[4-[(2S,3R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)propyl]-4-oxoazetidin-2-yl]phenyl]methyl]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 58632746 |
| Molecular Formula | C31H31F2NO7 |
| Molecular Weight | 567.59 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | (2S,3S,4R,5R,6S)-6-[[4-[(2S,3R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)propyl]-4-oxoazetidin-2-yl]phenyl]methyl]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1O[C@@H](Cc2ccc([C@@H]3[C@@H](CCCc4ccc(F)cc4)C(=O)N3c3ccc(F)cc3)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C31H31F2NO7/c32-20-10-6-17(7-11-20)2-1-3-23-25(34(30(23)38)22-14-12-21(33)13-15-22)19-8-4-18(5-9-19)16-24-26(35)27(36)28(37)29(41-24)31(39)40/h4-15,23-29,35-37H,1-3,16H2,(H,39,40)/t23-,24+,25-,26+,27-,28+,29+/m1/s1 |
| InChIKey | RFSXMWREOVZCKL-MCGYGMFZSA-N |
| XLogP | 3.17 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |