C26H30N2OSi — CID 58635708
N,3-diphenyl-1-pyridin-2-yl-3-triethylsilyloxyprop-2-en-1-imine (PubChem CID 58635708) has the molecular formula C26H30N2OSi and a molecular weight of 414.63 g/mol. Its IUPAC name is N,3-diphenyl-1-pyridin-2-yl-3-triethylsilyloxyprop-2-en-1-imine.
| Compound Name | N,3-diphenyl-1-pyridin-2-yl-3-triethylsilyloxyprop-2-en-1-imine |
|---|---|
| PubChem CID | 58635708 |
| Molecular Formula | C26H30N2OSi |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N,3-diphenyl-1-pyridin-2-yl-3-triethylsilyloxyprop-2-en-1-imine |
| SMILES | CC[Si](CC)(CC)OC(=C/C(=N/c1ccccc1)c1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C26H30N2OSi/c1-4-30(5-2,6-3)29-26(22-15-9-7-10-16-22)21-25(24-19-13-14-20-27-24)28-23-17-11-8-12-18-23/h7-21H,4-6H2,1-3H3/b26-21?,28-25- |
| InChIKey | YRMQASCGFRNGHY-PWUVHWSBSA-N |
| XLogP | 7.27 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|