About carbanide;methoxy-(1-phenyl-3-phenyliminobut-1-enyl)azanide;titanium(4+)
carbanide;methoxy-(1-phenyl-3-phenyliminobut-1-enyl)azanide;titanium(4+) (PubChem CID 58635794) has the molecular formula C20H26N2OTi
and a molecular weight of 358.31 g/mol. Its IUPAC name is carbanide;methoxy-(1-phenyl-3-phenyliminobut-1-enyl)azanide;titanium(4+).
Molecular Properties
| Compound Name | carbanide;methoxy-(1-phenyl-3-phenyliminobut-1-enyl)azanide;titanium(4+) |
| PubChem CID | 58635794 |
| Molecular Formula | C20H26N2OTi |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | carbanide;methoxy-(1-phenyl-3-phenyliminobut-1-enyl)azanide;titanium(4+) |
| SMILES | CO[N-]C(=C/C(C)=N/c1ccccc1)c1ccccc1.[CH3-].[CH3-].[CH3-].[Ti+4] |
| InChI | InChI=1S/C17H17N2O.3CH3.Ti/c1-14(18-16-11-7-4-8-12-16)13-17(19-20-2)15-9-5-3-6-10-15;;;;/h3-13H,1-2H3;3*1H3;/q4*-1;+4/b17-13?,18-14+;;;; |
| InChIKey | UUVYBOSGXITBGY-RDFSXHQASA-N |
| XLogP | 6.10 |
| TPSA | 35.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbanide;methoxy-(1-phenyl-3-phenyliminobut-1-enyl)azanide;titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;methoxy-(1-phenyl-3-phenyliminobut-1-enyl)azanide;titanium(4+)?
The IUPAC name of carbanide;methoxy-(1-phenyl-3-phenyliminobut-1-enyl)azanide;titanium(4+) (CID 58635794) is carbanide;methoxy-(1-phenyl-3-phenyliminobut-1-enyl)azanide;titanium(4+).
What is the SMILES notation for carbanide;methoxy-(1-phenyl-3-phenyliminobut-1-enyl)azanide;titanium(4+)?
The canonical SMILES for carbanide;methoxy-(1-phenyl-3-phenyliminobut-1-enyl)azanide;titanium(4+) is CO[N-]C(=C/C(C)=N/c1ccccc1)c1ccccc1.[CH3-].[CH3-].[CH3-].[Ti+4].
What is the InChIKey of carbanide;methoxy-(1-phenyl-3-phenyliminobut-1-enyl)azanide;titanium(4+)?
The InChIKey is UUVYBOSGXITBGY-RDFSXHQASA-N. The full InChI is InChI=1S/C17H17N2O.3CH3.Ti/c1-14(18-16-11-7-4-8-12-16)13-17(19-20-2)15-9-5-3-6-10-15;;;;/h3-13H,1-2H3;3*1H3;/q4*-1;+4/b17-13?,18-14+;;;;.
What are the key properties of carbanide;methoxy-(1-phenyl-3-phenyliminobut-1-enyl)azanide;titanium(4+)?
carbanide;methoxy-(1-phenyl-3-phenyliminobut-1-enyl)azanide;titanium(4+) has a molecular weight of 358.31 g/mol, XLogP of 6.10, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;methoxy-(1-phenyl-3-phenyliminobut-1-enyl)azanide;titanium(4+) is sourced from PubChem (CID 58635794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).