C39H41N5Ti — CID 58635680
[2-cyano-3-(2,6-dimethylphenyl)imino-1-phenylbut-1-enyl]-methylazanide;[3-(2,6-dimethylphenyl)imino-1-phenylbut-1-enyl]-methylazanide;titanium(2+) (PubChem CID 58635680) has the molecular formula C39H41N5Ti and a molecular weight of 627.66 g/mol. Its IUPAC name is [2-cyano-3-(2,6-dimethylphenyl)imino-1-phenylbut-1-enyl]-methylazanide;[3-(2,6-dimethylphenyl)imino-1-phenylbut-1-enyl]-methylazanide;titanium(2+).
| Compound Name | [2-cyano-3-(2,6-dimethylphenyl)imino-1-phenylbut-1-enyl]-methylazanide;[3-(2,6-dimethylphenyl)imino-1-phenylbut-1-enyl]-methylazanide;titanium(2+) |
|---|---|
| PubChem CID | 58635680 |
| Molecular Formula | C39H41N5Ti |
| Molecular Weight | 627.66 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | [2-cyano-3-(2,6-dimethylphenyl)imino-1-phenylbut-1-enyl]-methylazanide;[3-(2,6-dimethylphenyl)imino-1-phenylbut-1-enyl]-methylazanide;titanium(2+) |
| SMILES | C[N-]C(=C(C#N)/C(C)=N/c1c(C)cccc1C)c1ccccc1.C[N-]C(=C/C(C)=N/c1c(C)cccc1C)c1ccccc1.[Ti+2] |
| InChI | InChI=1S/C20H20N3.C19H21N2.Ti/c1-14-9-8-10-15(2)19(14)23-16(3)18(13-21)20(22-4)17-11-6-5-7-12-17;1-14-9-8-10-15(2)19(14)21-16(3)13-18(20-4)17-11-6-5-7-12-17;/h5-12H,1-4H3;5-13H,1-4H3;/q2*-1;+2/b20-18?,23-16+;18-13?,21-16+; |
| InChIKey | OZFCOYWSGADJCE-NKDILTCBSA-N |
| XLogP | 10.77 |
| TPSA | 76.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.66 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|