C15H23NO5 — CID 58636146
(4R)-4-[[(1S,4aR,7aS)-4,7-dimethyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl]oxyamino]-5-oxopentanoic acid (PubChem CID 58636146) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is (4R)-4-[[(1S,4aR,7aS)-4,7-dimethyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl]oxyamino]-5-oxopentanoic acid.
| Compound Name | (4R)-4-[[(1S,4aR,7aS)-4,7-dimethyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl]oxyamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 58636146 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (4R)-4-[[(1S,4aR,7aS)-4,7-dimethyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl]oxyamino]-5-oxopentanoic acid |
| SMILES | CC1=CO[C@@H](ON[C@@H](C=O)CCC(=O)O)[C@H]2C(C)CC[C@@H]12 |
| InChI | InChI=1S/C15H23NO5/c1-9-3-5-12-10(2)8-20-15(14(9)12)21-16-11(7-17)4-6-13(18)19/h7-9,11-12,14-16H,3-6H2,1-2H3,(H,18,19)/t9?,11-,12+,14+,15+/m1/s1 |
| InChIKey | OROXUFDXPCEXAR-SYRVVXJTSA-N |
| XLogP | 1.86 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|