C23H22N4O4 — CID 58636659
methyl 5-[[[4-(4-carbamimidoylphenyl)benzoyl]amino]methyl]-3-hydroxy-2-methylpyridine-4-carboxylate (PubChem CID 58636659) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is methyl 5-[[[4-(4-carbamimidoylphenyl)benzoyl]amino]methyl]-3-hydroxy-2-methylpyridine-4-carboxylate.
| Compound Name | methyl 5-[[[4-(4-carbamimidoylphenyl)benzoyl]amino]methyl]-3-hydroxy-2-methylpyridine-4-carboxylate |
|---|---|
| PubChem CID | 58636659 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | methyl 5-[[[4-(4-carbamimidoylphenyl)benzoyl]amino]methyl]-3-hydroxy-2-methylpyridine-4-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(C(=O)NCc3cnc(C)c(O)c3C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C23H22N4O4/c1-13-20(28)19(23(30)31-2)18(11-26-13)12-27-22(29)17-9-5-15(6-10-17)14-3-7-16(8-4-14)21(24)25/h3-11,28H,12H2,1-2H3,(H3,24,25)(H,27,29) |
| InChIKey | LXOXEQCRSSBUBB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 138.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|