C24H15F5N2OPt — CID 58637302
4-methoxy-2-(4-methylbenzene-6-id-1-yl)-6-pyridin-2-ylpyridine;1,2,3,4,5-pentafluorobenzene-6-ide;platinum(2+) (PubChem CID 58637302) has the molecular formula C24H15F5N2OPt and a molecular weight of 637.47 g/mol. Its IUPAC name is 4-methoxy-2-(4-methylbenzene-6-id-1-yl)-6-pyridin-2-ylpyridine;1,2,3,4,5-pentafluorobenzene-6-ide;platinum(2+).
| Compound Name | 4-methoxy-2-(4-methylbenzene-6-id-1-yl)-6-pyridin-2-ylpyridine;1,2,3,4,5-pentafluorobenzene-6-ide;platinum(2+) |
|---|---|
| PubChem CID | 58637302 |
| Molecular Formula | C24H15F5N2OPt |
| Molecular Weight | 637.47 g/mol |
| Exact Mass | 637.08 |
| IUPAC Name | 4-methoxy-2-(4-methylbenzene-6-id-1-yl)-6-pyridin-2-ylpyridine;1,2,3,4,5-pentafluorobenzene-6-ide;platinum(2+) |
| SMILES | COc1cc(-c2[c-]cc(C)cc2)nc(-c2ccccn2)c1.Fc1[c-]c(F)c(F)c(F)c1F.[Pt+2] |
| InChI | InChI=1S/C18H15N2O.C6F5.Pt/c1-13-6-8-14(9-7-13)17-11-15(21-2)12-18(20-17)16-5-3-4-10-19-16;7-2-1-3(8)5(10)6(11)4(2)9;/h3-8,10-12H,1-2H3;;/q2*-1;+2 |
| InChIKey | ZKZSIJJJUHXSQF-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|