C15H20N2O3 — CID 58639790
[(3aR,6aS)-6,6-dimethoxy-1,2,3,3a,5,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-phenylmethanone (PubChem CID 58639790) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is [(3aR,6aS)-6,6-dimethoxy-1,2,3,3a,5,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-phenylmethanone.
| Compound Name | [(3aR,6aS)-6,6-dimethoxy-1,2,3,3a,5,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 58639790 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | [(3aR,6aS)-6,6-dimethoxy-1,2,3,3a,5,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-phenylmethanone |
| SMILES | COC1(OC)CN(C(=O)c2ccccc2)[C@@H]2CCN[C@@H]21 |
| InChI | InChI=1S/C15H20N2O3/c1-19-15(20-2)10-17(12-8-9-16-13(12)15)14(18)11-6-4-3-5-7-11/h3-7,12-13,16H,8-10H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | KTEZUQUMJCURLP-OLZOCXBDSA-N |
| XLogP | 0.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|