C28H24N3+3 — CID 58640790
(1S)-3,29,31-triazoniaoctacyclo[14.12.1.11,10.14,26.03,8.020,29.022,27.014,31]hentriaconta-3,5,7,10(31),11,13,16,18,20(29),22,24,26-dodecaene (PubChem CID 58640790) has the molecular formula C28H24N3+3 and a molecular weight of 402.52 g/mol. Its IUPAC name is (1S)-3,29,31-triazoniaoctacyclo[14.12.1.11,10.14,26.03,8.020,29.022,27.014,31]hentriaconta-3,5,7,10(31),11,13,16,18,20(29),22,24,26-dodecaene.
| Compound Name | (1S)-3,29,31-triazoniaoctacyclo[14.12.1.11,10.14,26.03,8.020,29.022,27.014,31]hentriaconta-3,5,7,10(31),11,13,16,18,20(29),22,24,26-dodecaene |
|---|---|
| PubChem CID | 58640790 |
| Molecular Formula | C28H24N3+3 |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (1S)-3,29,31-triazoniaoctacyclo[14.12.1.11,10.14,26.03,8.020,29.022,27.014,31]hentriaconta-3,5,7,10(31),11,13,16,18,20(29),22,24,26-dodecaene |
| SMILES | c1cc2c3c(c1)Cc1cccc4[n+]1[C@]1(C3)C[n+]3c(cccc3Cc3cccc([n+]31)C4)C2 |
| InChI | InChI=1S/C28H24N3/c1-5-19-13-21-7-2-8-22-15-24-10-4-12-26-16-25-11-3-9-23-14-20(6-1)27(19)17-28(30(23)25,31(24)26)18-29(21)22/h1-12H,13-18H2/q+3/t28-/m0/s1 |
| InChIKey | FRVNNTPZDLZTHH-NDEPHWFRSA-N |
| XLogP | 2.31 |
| TPSA | 11.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|