C28H21N3+2 — CID 160639332
2-aza-28,29-diazoniaoctacyclo[13.13.1.11,17.12,5.011,29.023,28.09,31.021,30]hentriaconta-3,5(31),6,8,11,13,15(29),17,19,21(30),23,25,27-tridecaene (PubChem CID 160639332) has the molecular formula C28H21N3+2 and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-aza-28,29-diazoniaoctacyclo[13.13.1.11,17.12,5.011,29.023,28.09,31.021,30]hentriaconta-3,5(31),6,8,11,13,15(29),17,19,21(30),23,25,27-tridecaene.
| Compound Name | 2-aza-28,29-diazoniaoctacyclo[13.13.1.11,17.12,5.011,29.023,28.09,31.021,30]hentriaconta-3,5(31),6,8,11,13,15(29),17,19,21(30),23,25,27-tridecaene |
|---|---|
| PubChem CID | 160639332 |
| Molecular Formula | C28H21N3+2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-aza-28,29-diazoniaoctacyclo[13.13.1.11,17.12,5.011,29.023,28.09,31.021,30]hentriaconta-3,5(31),6,8,11,13,15(29),17,19,21(30),23,25,27-tridecaene |
| SMILES | c1cc2c3c(c1)Cc1cccc4[n+]1C3(n1ccc3cccc(c31)C4)[n+]1ccccc1C2 |
| InChI | InChI=1S/C28H21N3/c1-2-14-29-23(10-1)16-20-7-4-8-21-17-24-11-5-12-25-18-22-9-3-6-19-13-15-30(27(19)22)28(29,26(20)21)31(24)25/h1-15H,16-18H2/q+2 |
| InChIKey | QORKRBBWTJZWEP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|