C12H20O — CID 58644804
3-[(2E)-1-methyl-2-propylidenecyclobutyl]butan-2-one (PubChem CID 58644804) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 3-[(2E)-1-methyl-2-propylidenecyclobutyl]butan-2-one.
| Compound Name | 3-[(2E)-1-methyl-2-propylidenecyclobutyl]butan-2-one |
|---|---|
| PubChem CID | 58644804 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 3-[(2E)-1-methyl-2-propylidenecyclobutyl]butan-2-one |
| SMILES | CC/C=C1\CCC1(C)C(C)C(C)=O |
| InChI | InChI=1S/C12H20O/c1-5-6-11-7-8-12(11,4)9(2)10(3)13/h6,9H,5,7-8H2,1-4H3/b11-6+ |
| InChIKey | QOZCTBMKABMEGA-IZZDOVSWSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|