C10H19I — CID 58644913
(1S,2R,3R,4R)-2-ethyl-3-(iodomethyl)-1,4-dimethylcyclopentane (PubChem CID 58644913) has the molecular formula C10H19I and a molecular weight of 266.17 g/mol. Its IUPAC name is (1S,2R,3R,4R)-2-ethyl-3-(iodomethyl)-1,4-dimethylcyclopentane.
| Compound Name | (1S,2R,3R,4R)-2-ethyl-3-(iodomethyl)-1,4-dimethylcyclopentane |
|---|---|
| PubChem CID | 58644913 |
| Molecular Formula | C10H19I |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | (1S,2R,3R,4R)-2-ethyl-3-(iodomethyl)-1,4-dimethylcyclopentane |
| SMILES | CC[C@H]1[C@H](CI)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C10H19I/c1-4-9-7(2)5-8(3)10(9)6-11/h7-10H,4-6H2,1-3H3/t7-,8+,9+,10+/m0/s1 |
| InChIKey | FMBSKXXNDWQHQK-SGIHWFKDSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|