C11H16O — CID 58644924
(3aS,6aR)-4-ethyl-5-methyl-2-methylidene-3,3a,6,6a-tetrahydrocyclopenta[b]furan (PubChem CID 58644924) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (3aS,6aR)-4-ethyl-5-methyl-2-methylidene-3,3a,6,6a-tetrahydrocyclopenta[b]furan.
| Compound Name | (3aS,6aR)-4-ethyl-5-methyl-2-methylidene-3,3a,6,6a-tetrahydrocyclopenta[b]furan |
|---|---|
| PubChem CID | 58644924 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (3aS,6aR)-4-ethyl-5-methyl-2-methylidene-3,3a,6,6a-tetrahydrocyclopenta[b]furan |
| SMILES | C=C1C[C@H]2C(CC)=C(C)C[C@H]2O1 |
| InChI | InChI=1S/C11H16O/c1-4-9-7(2)5-11-10(9)6-8(3)12-11/h10-11H,3-6H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | WFSXBAGUVRDCON-WDEREUQCSA-N |
| XLogP | 3.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|