C35H34ClN2O6S2+ — CID 58648783
[2-[3-chloro-5-[1,1-dimethyl-3-(sulfomethyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]methanesulfonic acid (PubChem CID 58648783) has the molecular formula C35H34ClN2O6S2+ and a molecular weight of 678.25 g/mol. Its IUPAC name is [2-[3-chloro-5-[1,1-dimethyl-3-(sulfomethyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]methanesulfonic acid.
| Compound Name | [2-[3-chloro-5-[1,1-dimethyl-3-(sulfomethyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 58648783 |
| Molecular Formula | C35H34ClN2O6S2+ |
| Molecular Weight | 678.25 g/mol |
| Exact Mass | 677.15 |
| IUPAC Name | [2-[3-chloro-5-[1,1-dimethyl-3-(sulfomethyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]methanesulfonic acid |
| SMILES | CC1(C)C(=CC=C(Cl)C=CC2=[N+](CS(=O)(=O)O)c3ccc4ccccc4c3C2(C)C)N(CS(=O)(=O)O)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C35H33ClN2O6S2/c1-34(2)30(37(21-45(39,40)41)28-17-13-23-9-5-7-11-26(23)32(28)34)19-15-25(36)16-20-31-35(3,4)33-27-12-8-6-10-24(27)14-18-29(33)38(31)22-46(42,43)44/h5-20H,21-22H2,1-4H3,(H-,39,40,41,42,43,44)/p+1 |
| InChIKey | SRDUUISUGVMFQS-UHFFFAOYSA-O |
| XLogP | 7.42 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.25 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|