C14H13F3N2O — CID 58652321
(4S)-4-[(E)-2-cyclopropylethenyl]-4-(trifluoromethyl)-1,3-dihydroquinazolin-2-one (PubChem CID 58652321) has the molecular formula C14H13F3N2O and a molecular weight of 282.26 g/mol. Its IUPAC name is (4S)-4-[(E)-2-cyclopropylethenyl]-4-(trifluoromethyl)-1,3-dihydroquinazolin-2-one.
| Compound Name | (4S)-4-[(E)-2-cyclopropylethenyl]-4-(trifluoromethyl)-1,3-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 58652321 |
| Molecular Formula | C14H13F3N2O |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (4S)-4-[(E)-2-cyclopropylethenyl]-4-(trifluoromethyl)-1,3-dihydroquinazolin-2-one |
| SMILES | O=C1Nc2ccccc2[C@@](/C=C/C2CC2)(C(F)(F)F)N1 |
| InChI | InChI=1S/C14H13F3N2O/c15-14(16,17)13(8-7-9-5-6-9)10-3-1-2-4-11(10)18-12(20)19-13/h1-4,7-9H,5-6H2,(H2,18,19,20)/b8-7+/t13-/m0/s1 |
| InChIKey | LVUPJIUTXOFZMA-GWJCSSMESA-N |
| XLogP | 3.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|