C15H15F3N2O — CID 59948007
5-(2-cyclopropylethenyl)-5-(trifluoromethyl)-3,4-dihydro-1H-1,3-benzodiazepin-2-one (PubChem CID 59948007) has the molecular formula C15H15F3N2O and a molecular weight of 296.29 g/mol. Its IUPAC name is 5-(2-cyclopropylethenyl)-5-(trifluoromethyl)-3,4-dihydro-1H-1,3-benzodiazepin-2-one.
| Compound Name | 5-(2-cyclopropylethenyl)-5-(trifluoromethyl)-3,4-dihydro-1H-1,3-benzodiazepin-2-one |
|---|---|
| PubChem CID | 59948007 |
| Molecular Formula | C15H15F3N2O |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 5-(2-cyclopropylethenyl)-5-(trifluoromethyl)-3,4-dihydro-1H-1,3-benzodiazepin-2-one |
| SMILES | O=C1NCC(C=CC2CC2)(C(F)(F)F)c2ccccc2N1 |
| InChI | InChI=1S/C15H15F3N2O/c16-15(17,18)14(8-7-10-5-6-10)9-19-13(21)20-12-4-2-1-3-11(12)14/h1-4,7-8,10H,5-6,9H2,(H2,19,20,21) |
| InChIKey | KZCQFNMWPZWMMH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|