C19H22N2O — CID 10517906
12,12-diethyl-8,10-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaen-9-one (PubChem CID 10517906) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 12,12-diethyl-8,10-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaen-9-one.
| Compound Name | 12,12-diethyl-8,10-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaen-9-one |
|---|---|
| PubChem CID | 10517906 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 12,12-diethyl-8,10-diazatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaen-9-one |
| SMILES | CCC1(CC)CNC(=O)Nc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H22N2O/c1-3-19(4-2)13-20-18(22)21-17-12-8-6-10-15(17)14-9-5-7-11-16(14)19/h5-12H,3-4,13H2,1-2H3,(H2,20,21,22) |
| InChIKey | WROLMFFQFILTFD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |